What is the molecular formula of cellulase?
The molecular formula of cellulase is C18H32O16.
What is the molecular weight of cellulase?
The molecular weight of cellulase is 504.4 g/mol.
What is the IUPAC name of cellulase?
The IUPAC name of cellulase is (2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the InChI of cellulase?
The InChI of cellulase is InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16-,17+,18+/m1/s1.
What is the CAS number of cellulase?
The CAS number of cellulase is 9012-54-8.
What is the European Community (EC) number of cellulase?
The European Community (EC) number of cellulase is 232-734-4.
What is the XLogP3-AA value of cellulase?
The XLogP3-AA value of cellulase is -6.9.
How many hydrogen bond donor counts are there in cellulase?
There are 11 hydrogen bond donor counts in cellulase.
How many hydrogen bond acceptor counts are there in cellulase?
There are 16 hydrogen bond acceptor counts in cellulase.
What is the exact mass of cellulase?
The exact mass of cellulase is 504.16903493 g/mol.