What is the molecular formula of chondroitin?
The molecular formula of chondroitin is C14H21NO11.
What is the synonyms of chondroitin?
The synonyms of chondroitin are: chondroitin (3R,4R)-2-{[(2R,3S,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
What is the molecular weight of chondroitin?
The molecular weight of chondroitin is 379.32 g/mol.
When was chondroitin created?
Chondroitin was created on November 9, 2011.
What is chondroitin a constituent of?
Chondroitin is a constituent of chondrin.
What is the IUPAC name of chondroitin?
The IUPAC name of chondroitin is (3R,4R)-2-[(2R,3S,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
What is the InChI of chondroitin?
The InChI of chondroitin is InChI=1S/C14H21NO11/c1-4(17)15-8-11(10(20)7(3-16)24-13(8)23)26-14-9(19)5(18)2-6(25-14)12(21)22/h2,5,7-11,13-14,16,18-20,23H,3H2,1H3,(H,15,17)(H,21,22)/t5-,7-,8+,9-,10+,11-,13-,14?/m1/s1.
What is the InChIKey of chondroitin?
The InChIKey of chondroitin is DLGJWSVWTWEWBJ-HGGSSLSASA-N.
What is the Canonical SMILES of chondroitin?
The Canonical SMILES of chondroitin is CC(=O)NC1C(C(C(OC1O)CO)O)OC2C(C(C=C(O2)C(=O)O)O)O.
What is the CAS number of chondroitin?
The CAS number of chondroitin is 9007-27-6.