What is the molecular formula of Potassium alginate?
The molecular formula of Potassium alginate is C12H16K2O13.
What is the molecular weight of Potassium alginate?
The molecular weight of Potassium alginate is 446.44 g/mol.
What are the synonyms of Potassium alginate?
The synonyms of Potassium alginate are POTASSIUM ALGINATE, 9005-36-1, Alginic acid, potassium salt dipotassium.
What is the parent compound of Potassium alginate?
The parent compound of Potassium alginate is CID 91847812 (D-Dimannuronic acid).
What are the component compounds of Potassium alginate?
The component compounds of Potassium alginate are CID 91847812 (D-Dimannuronic acid) and CID 5462222 (Potassium).
When was Potassium alginate created and modified?
Potassium alginate was created on 2015-10-05 and modified on 2023-12-30.
What are the medical uses of Potassium alginate?
Potassium alginate is used as hydrogels, dental impression materials, absorbent materials for surgical dressings, and for manufacturing microspheres and nanoparticles for diagnostic reagent kits and drug delivery systems.
What is the IUPAC name of Potassium alginate?
The IUPAC name of Potassium alginate is dipotassium;(2S,3S,4S,5S,6R)-6-[(2S,3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
What is the InChI of Potassium alginate?
The InChI of Potassium alginate is InChI=1S/C12H18O13.2K/c13-1-2(14)7(9(18)19)25-12(5(1)17)24-6-3(15)4(16)11(22)23-8(6)10(20)21;;/h1-8,11-17,22H,(H,18,19)(H,20,21);;/q;2*+1/p-2/t1-,2-,3+,4-,5-,6-,7-,8-,11+,12+;;/m0../s1.
What is the CAS number of Potassium alginate?
The CAS number of Potassium alginate is 9005-36-1.