What is the molecular formula of evening primrose oil?
The molecular formula of evening primrose oil is C18H34O2.
What is the molecular weight of evening primrose oil?
The molecular weight of evening primrose oil is 282.5 g/mol.
What are some synonyms for evening primrose oil?
Some synonyms for evening primrose oil are oleic acid, cis-9-Octadecenoic acid, and elaidoic acid.
What is the IUPAC name of evening primrose oil?
The IUPAC name of evening primrose oil is (Z)-octadec-9-enoic acid.
What is the InChIKey for evening primrose oil?
The InChIKey for evening primrose oil is ZQPPMHVWECSIRJ-KTKRTIGZSA-N.
What is the canonical SMILES representation of evening primrose oil?
The canonical SMILES representation of evening primrose oil is CCCCCCCCC=CCCCCCCCC(=O)O.
What is the CAS number for evening primrose oil?
The CAS number for evening primrose oil is 112-80-1.
What is the ChEMBL ID for evening primrose oil?
The ChEMBL ID for evening primrose oil is CHEMBL8659.
What is the FEMA number for evening primrose oil?
The FEMA number for evening primrose oil is 2815.
What is the JECFA number for evening primrose oil?
The JECFA number for evening primrose oil is 333.