Bis(butylcyclopentadienyl)tungsten(IV) dibromide can significantly improve the yield of phenylpropionitrile and phenylbutyronitrile into amide, and has high selectivity and activity.
What is the molecular formula of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The molecular formula is C18H26W.
What is the molecular weight of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The molecular weight is 426.2 g/mol.
What are the synonyms for Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The synonyms are "Bis(butylcyclopentadienyl)tungsten(IV) dibromide".
What is the InChI of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The InChI is "InChI=1S/2C9H13.W/c2*1-2-3-6-9-7-4-5-8-9;/h2*4-5,7-8H,2-3,6H2,1H3;".
What is the InChIKey of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The InChIKey is "MNEYEPWIUXXLJB-UHFFFAOYSA-N".
What is the canonical SMILES of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The canonical SMILES is "CCCC[C]1[CH][CH][CH][CH]1.CCCC[C]1[CH][CH][CH][CH]1.[W]".
What is the hydrogen bond donor count of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The hydrogen bond acceptor count is 0.
What is the rotatable bond count of Bis(butylcyclopentadienyl)tungsten(IV) dibromide?
The rotatable bond count is 6.
Is Bis(butylcyclopentadienyl)tungsten(IV) dibromide a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.