What is the molecular formula of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The molecular formula of tert-Butyl 4-amino-2-fluorobenzylcarbamate is C12H17FN2O2.
What is the molecular weight of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The molecular weight of tert-Butyl 4-amino-2-fluorobenzylcarbamate is 240.27 g/mol.
What is the IUPAC name of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The IUPAC name of tert-Butyl 4-amino-2-fluorobenzylcarbamate is tert-butyl N-[(4-amino-2-fluorophenyl)methyl]carbamate.
What is the InChI of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The InChI of tert-Butyl 4-amino-2-fluorobenzylcarbamate is InChI=1S/C12H17FN2O2/c1-12(2,3)17-11(16)15-7-8-4-5-9(14)6-10(8)13/h4-6H,7,14H2,1-3H3,(H,15,16).
What is the InChIKey of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The InChIKey of tert-Butyl 4-amino-2-fluorobenzylcarbamate is FKSOCOFHSAAXCX-UHFFFAOYSA-N.
What is the canonical SMILES of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The canonical SMILES of tert-Butyl 4-amino-2-fluorobenzylcarbamate is CC(C)(C)OC(=O)NCC1=C(C=C(C=C1)N)F.
What is the CAS number of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The CAS number of tert-Butyl 4-amino-2-fluorobenzylcarbamate is 900174-92-7.
What is the European Community (EC) Number of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The European Community (EC) Number of tert-Butyl 4-amino-2-fluorobenzylcarbamate is 847-698-0.
What is the DSSTox Substance ID of tert-Butyl 4-amino-2-fluorobenzylcarbamate?
The DSSTox Substance ID of tert-Butyl 4-amino-2-fluorobenzylcarbamate is DTXSID60701788.
Is tert-Butyl 4-amino-2-fluorobenzylcarbamate considered as a canonicalized compound?
Yes, tert-Butyl 4-amino-2-fluorobenzylcarbamate is considered a canonicalized compound.
※ Please kindly note that our products are for research use only.