What is the molecular formula of Piperphenidol?
The molecular formula of Piperphenidol is C18H29NO.
When was Piperphenidol created?
Piperphenidol was created on August 9, 2005.
What is the molecular weight of Piperphenidol?
The molecular weight of Piperphenidol is 275.4 g/mol.
What is the IUPAC name of Piperphenidol?
The IUPAC name of Piperphenidol is 5-methyl-4-phenyl-1-piperidin-1-ylhexan-3-ol.
What is the InChI of Piperphenidol?
The InChI of Piperphenidol is InChI=1S/C18H29NO/c1-15(2)18(16-9-5-3-6-10-16)17(20)11-14-19-12-7-4-8-13-19/h3,5-6,9-10,15,17-18,20H,4,7-8,11-14H2,1-2H3.
How many hydrogen bond donor counts does Piperphenidol have?
Piperphenidol has a hydrogen bond donor count of 1.
What is the XLogP3-AA value of Piperphenidol?
The XLogP3-AA value of Piperphenidol is 3.9.
What is the topological polar surface area of Piperphenidol?
The topological polar surface area of Piperphenidol is 23.5 Å2.
How many rotatable bond counts does Piperphenidol have?
Piperphenidol has a rotatable bond count of 6.
Is Piperphenidol a canonicalized compound?
Yes, Piperphenidol is a canonicalized compound.