What is the PubChem CID for D-Valinol?
The PubChem CID for D-Valinol is 6950587.
What is the molecular formula of D-Valinol?
The molecular formula of D-Valinol is C5H13NO.
What is the molecular weight of D-Valinol?
The molecular weight of D-Valinol is 103.16 g/mol.
What is the IUPAC name of D-Valinol?
The IUPAC name of D-Valinol is (2R)-2-amino-3-methylbutan-1-ol.
What is the InChI of D-Valinol?
The InChI of D-Valinol is InChI=1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/t5-/m0/s1.
What is the InChIKey of D-Valinol?
The InChIKey of D-Valinol is NWYYWIJOWOLJNR-YFKPBYRVSA-N.
What is the CAS number of D-Valinol?
The CAS number of D-Valinol is 4276-09-9.
What is the XLogP3-AA value of D-Valinol?
The XLogP3-AA value of D-Valinol is 0.
How many hydrogen bond donor counts does D-Valinol have?
D-Valinol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does D-Valinol have?
D-Valinol has 2 hydrogen bond acceptor counts.