What is the molecular formula of tiludronic acid?
The molecular formula of tiludronic acid is C7H9ClO6P2S.
What is the molecular weight of tiludronic acid?
The molecular weight of tiludronic acid is 318.61 g/mol.
What is the IUPAC name of tiludronic acid?
The IUPAC name of tiludronic acid is [(4-chlorophenyl)sulfanyl-phosphonomethyl]phosphonic acid.
When was tiludronic acid created?
Tiludronic acid was created on June 24, 2005.
When was tiludronic acid last modified?
Tiludronic acid was last modified on December 30, 2023.
What is the FDA approval status of tiludronic acid?
Tiludronic acid was granted FDA approval on March 7, 1997.
What is the CAS number of tiludronic acid?
The CAS number of tiludronic acid is 89987-06-4.
What are some synonyms for tiludronic acid?
Some synonyms for tiludronic acid include Tiludronate, Skelid, and Acide tiludronique.
What is the canonical SMILES representation of tiludronic acid?
The canonical SMILES representation of tiludronic acid is C1=CC(=CC=C1SC(P(=O)(O)O)P(=O)(O)O)Cl.
What is the XLogP3-AA value of tiludronic acid?
The XLogP3-AA value of tiludronic acid is -0.3.