What is the chemical formula of Ajmaline?
The chemical formula of Ajmaline is C20H26N2O2.
What is the molecular weight of Ajmaline?
The molecular weight of Ajmaline is 326.4 g/mol.
What is the IUPAC name of Ajmaline?
The IUPAC name of Ajmaline is (1R,9R,10S,12R,13S,14R,16S,17S,18R)-13-ethyl-8-methyl-8,15-diazahexacyclo[14.2.1.0 1,9 .0 2,7 .0 10,15 .0 12,17]nonadeca-2,4,6-triene-14,18-diol.
What is the InChIKey of Ajmaline?
The InChIKey of Ajmaline is CJDRUOGAGYHKKD-RQBLFBSQSA-N.
What is the Canonical SMILES of Ajmaline?
The Canonical SMILES of Ajmaline is CCC1C2CC3C4C5(CC(C2C5O)N3C1O)C6=CC=CC=C6N4C.
What is the CAS number of Ajmaline?
The CAS number of Ajmaline is 4360-12-7.
What is the UNII of Ajmaline?
The UNII of Ajmaline is 1PON08459R.
What is the European Community (EC) number of Ajmaline?
The European Community (EC) number of Ajmaline is 224-439-4.
What is the NCI Thesaurus Code of Ajmaline?
The NCI Thesaurus Code of Ajmaline is C83524.
What is the Wikipedia page for Ajmaline?
The Wikipedia page for Ajmaline can be found by searching for "Ajmaline" on Wikipedia.