What is the molecular formula of 3-Bromo-9-(4-biphenylyl)carbazole?
The molecular formula of 3-Bromo-9-(4-biphenylyl)carbazole is C24H16BrN.
What is the molecular weight of 3-Bromo-9-(4-biphenylyl)carbazole?
The molecular weight of 3-Bromo-9-(4-biphenylyl)carbazole is 398.3 g/mol.
What is the IUPAC name of 3-Bromo-9-(4-biphenylyl)carbazole?
The IUPAC name of 3-Bromo-9-(4-biphenylyl)carbazole is 3-bromo-9-(4-phenylphenyl)carbazole.
What is the InChI of 3-Bromo-9-(4-biphenylyl)carbazole?
The InChI of 3-Bromo-9-(4-biphenylyl)carbazole is InChI=1S/C24H16BrN/c25-19-12-15-24-22(16-19)21-8-4-5-9-23(21)26(24)20-13-10-18(11-14-20)17-6-2-1-3-7-17/h1-16H.
What is the InChIKey of 3-Bromo-9-(4-biphenylyl)carbazole?
The InChIKey of 3-Bromo-9-(4-biphenylyl)carbazole is MOCNGNGLTRMQQH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-9-(4-biphenylyl)carbazole?
The canonical SMILES of 3-Bromo-9-(4-biphenylyl)carbazole is C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=C(C=C(C=C4)Br)C5=CC=CC=C53.
What is the CAS number of 3-Bromo-9-(4-biphenylyl)carbazole?
The CAS number of 3-Bromo-9-(4-biphenylyl)carbazole is 894791-46-9.
What is the EC number of 3-Bromo-9-(4-biphenylyl)carbazole?
The EC number of 3-Bromo-9-(4-biphenylyl)carbazole is 807-957-0.
Is 3-Bromo-9-(4-biphenylyl)carbazole a canonicalized compound?
Yes, 3-Bromo-9-(4-biphenylyl)carbazole is a canonicalized compound.
※ Please kindly note that our products are for research use only.
Download
![tert-Butyl4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]piperidine-1-carboxylate](https://resource.alfa-chemistry.com/structure/877399-74-1.gif)
