What is the molecular formula of 2-Methylbenzyl alcohol?
The molecular formula of 2-Methylbenzyl alcohol is C8H10O.
What is the molecular weight of 2-Methylbenzyl alcohol?
The molecular weight of 2-Methylbenzyl alcohol is 122.16 g/mol.
What is the IUPAC name of 2-Methylbenzyl alcohol?
The IUPAC name of 2-Methylbenzyl alcohol is (2-methylphenyl)methanol.
What is the InChI of 2-Methylbenzyl alcohol?
The InChI of 2-Methylbenzyl alcohol is "InChI=1S/C8H10O/c1-7-4-2-3-5-8(7)6-9/h2-5,9H,6H2,1H3."
What is the InChIKey of 2-Methylbenzyl alcohol?
The InChIKey of 2-Methylbenzyl alcohol is "XPNGNIFUDRPBFJ-UHFFFAOYSA-N."
What is the canonical SMILES of 2-Methylbenzyl alcohol?
The canonical SMILES of 2-Methylbenzyl alcohol is "CC1=CC=CC=C1CO."
What is the CAS number of 2-Methylbenzyl alcohol?
The CAS number of 2-Methylbenzyl alcohol is 89-95-2.
What is the European Community (EC) number of 2-Methylbenzyl alcohol?
The European Community (EC) number of 2-Methylbenzyl alcohol is 201-954-2.
What is the Monoisotopic Mass of 2-Methylbenzyl alcohol?
The Monoisotopic Mass of 2-Methylbenzyl alcohol is 122.073164938 g/mol.
How many defined bond stereocenter counts does 2-Methylbenzyl alcohol have?
2-Methylbenzyl alcohol has 0 defined bond stereocenter counts.