What is the molecular formula of L-Glutaminyl-L-glutamic Acid?
The molecular formula of L-Glutaminyl-L-glutamic Acid is C10H17N3O6.
What is another name for L-Glutaminyl-L-glutamic Acid?
Another name for L-Glutaminyl-L-glutamic Acid is Gln-Glu.
What is the molecular weight of L-Glutaminyl-L-glutamic Acid?
The molecular weight of L-Glutaminyl-L-glutamic Acid is 275.26 g/mol.
When was L-Glutaminyl-L-glutamic Acid created?
L-Glutaminyl-L-glutamic Acid was created on July 29, 2006.
What is the role of L-Glutaminyl-L-glutamic Acid?
L-Glutaminyl-L-glutamic Acid has a role as a metabolite.
What is the IUPAC name of L-Glutaminyl-L-glutamic Acid?
The IUPAC name of L-Glutaminyl-L-glutamic Acid is (2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]pentanedioic acid.
What is the InChI of L-Glutaminyl-L-glutamic Acid?
The InChI of L-Glutaminyl-L-glutamic Acid is InChI=1S/C10H17N3O6/c11-5(1-3-7(12)14)9(17)13-6(10(18)19)2-4-8(15)16/h5-6H,1-4,11H2,(H2,12,14)(H,13,17)(H,15,16)(H,18,19)/t5-,6-/m0/s1.
What is the InChIKey of L-Glutaminyl-L-glutamic Acid?
The InChIKey of L-Glutaminyl-L-glutamic Acid is OWOFCNWTMWOOJJ-WDSKDSINSA-N.
What is the CAS number of L-Glutaminyl-L-glutamic Acid?
The CAS number of L-Glutaminyl-L-glutamic Acid is 88830-90-4.
What are the physical properties of L-Glutaminyl-L-glutamic Acid?
L-Glutaminyl-L-glutamic Acid is a solid in physical description.
※ Please kindly note that our products are for research use only.