Under the catalysis of different transition metals, 2-Methyl-2H-indazole-4-boronic acid pinacol ester can react with many organic compounds to form different organoboron intermediates.
What is the molecular formula of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The molecular formula is C14H19BN2O2.
What is the molecular weight of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The molecular weight is 258.13 g/mol.
What is the IUPAC name of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The IUPAC name is 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
What is the InChI of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The InChI is InChI=1S/C14H19BN2O2/c1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-17(5)16-12/h6-9H,1-5H3.
What is the InChIKey of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The InChIKey is YQMBOMPXHDRRIM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=CC3=NN(C=C23)C.
What is the CAS number of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The CAS number is 885698-95-3.
What is the hydrogen bond donor count of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 2-Methyl-2H-indazole-4-boronic acid pinacol ester?
The hydrogen bond acceptor count is 3.
※ Please kindly note that our products are for research use only.