What is the molecular formula of 4-Bromo-7-methylisatin?
The molecular formula of 4-Bromo-7-methylisatin is C9H6BrNO2.
What is the molecular weight of 4-Bromo-7-methylisatin?
The molecular weight of 4-Bromo-7-methylisatin is 240.05 g/mol.
What is the IUPAC name of 4-Bromo-7-methylisatin?
The IUPAC name of 4-Bromo-7-methylisatin is 4-bromo-7-methyl-1H-indole-2,3-dione.
What is the InChI of 4-Bromo-7-methylisatin?
The InChI of 4-Bromo-7-methylisatin is InChI=1S/C9H6BrNO2/c1-4-2-3-5(10)6-7(4)11-9(13)8(6)12/h2-3H,1H3,(H,11,12,13).
What is the InChIKey of 4-Bromo-7-methylisatin?
The InChIKey of 4-Bromo-7-methylisatin is VYPAAYCDBZXFOI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-7-methylisatin?
The canonical SMILES of 4-Bromo-7-methylisatin is CC1=C2C(=C(C=C1)Br)C(=O)C(=O)N2.
What is the CAS number of 4-Bromo-7-methylisatin?
The CAS number of 4-Bromo-7-methylisatin is 874375-17-4.
How many hydrogen bond donor count does 4-Bromo-7-methylisatin have?
4-Bromo-7-methylisatin has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 4-Bromo-7-methylisatin have?
4-Bromo-7-methylisatin has 2 hydrogen bond acceptor counts.