3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid can efficiently catalyze the condensation reaction of β -hydroxycarboxylic acid with weak activity.
What is the PubChem CID for 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
PubChem CID 44886928.
What is the molecular formula of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The molecular formula is C11H15BFNO3.
What are the synonyms for 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The synonyms include 871332-64-8, (3-(Diethylcarbamoyl)-5-fluorophenyl)boronic acid, [3-(diethylcarbamoyl)-5-fluorophenyl]boronic acid, and 3-(diethylcarbamoyl)-5-fluorophenylboronic acid.
What is the molecular weight of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The molecular weight is 239.05 g/mol.
When was 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid created?
It was created on March 23, 2010.
What is the IUPAC name of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The IUPAC name is [3-(diethylcarbamoyl)-5-fluorophenyl]boronic acid.
What is the InChI of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The InChI is InChI=1S/C11H15BFNO3/c1-3-14(4-2)11(15)8-5-9(12(16)17)7-10(13)6-8/h5-7,16-17H,3-4H2,1-2H3.
What is the InChIKey of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The InChIKey is PWFQDNPXVAYCOK-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1)F)C(=O)N(CC)CC)(O)O.
What is the CAS number of 3-Fluoro-5-(diethylcarbamoyl)phenylboronic acid?
The CAS number is 871332-64-8.
※ Please kindly note that our products are for research use only.