What is the molecular formula of 2,4,6-Trichloroanisole?
The molecular formula of 2,4,6-Trichloroanisole is C7H5Cl3O.
What is the molecular weight of 2,4,6-Trichloroanisole?
The molecular weight of 2,4,6-Trichloroanisole is 211.5 g/mol.
What is the IUPAC name of 2,4,6-Trichloroanisole?
The IUPAC name of 2,4,6-Trichloroanisole is 1,3,5-trichloro-2-methoxybenzene.
What is the InChI of 2,4,6-Trichloroanisole?
The InChI of 2,4,6-Trichloroanisole is InChI=1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3.
What is the InChIKey of 2,4,6-Trichloroanisole?
The InChIKey of 2,4,6-Trichloroanisole is WCVOGSZTONGSQY-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,6-Trichloroanisole?
The canonical SMILES of 2,4,6-Trichloroanisole is COC1=C(C=C(C=C1Cl)Cl)Cl.
What is the CAS number of 2,4,6-Trichloroanisole?
The CAS number of 2,4,6-Trichloroanisole is 87-40-1.
What is the European Community (EC) number of 2,4,6-Trichloroanisole?
The European Community (EC) number of 2,4,6-Trichloroanisole is 201-743-5.
What is the UNII of 2,4,6-Trichloroanisole?
The UNII of 2,4,6-Trichloroanisole is 31O3X41254.
What is the KEGG ID of 2,4,6-Trichloroanisole?
The KEGG ID of 2,4,6-Trichloroanisole is C11510.