What is the molecular formula of Z-Pro-prolinal?
The molecular formula of Z-Pro-prolinal is C18H22N2O4.
What are the synonyms of Z-Pro-prolinal?
The synonyms of Z-Pro-prolinal include N-Benzyloxycarbonylprolylprolinal, n-benzyloxycarbonyl-l-prolyl-l-prolinal, N-Benzyloxycarbonyl-prolyl-prolinal, and z-prolyl-prolinal.
What is the molecular weight of Z-Pro-prolinal?
The molecular weight of Z-Pro-prolinal is 330.4 g/mol.
What is the IUPAC name of Z-Pro-prolinal?
The IUPAC name of Z-Pro-prolinal is benzyl (2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
What is the InChI of Z-Pro-prolinal?
The InChI of Z-Pro-prolinal is InChI=1S/C18H22N2O4/c21-12-15-8-4-10-19(15)17(22)16-9-5-11-20(16)18(23)24-13-14-6-2-1-3-7-14/h1-3,6-7,12,15-16H,4-5,8-11,13H2/t15-,16-/m0/s1.
What is the InChIKey of Z-Pro-prolinal?
The InChIKey of Z-Pro-prolinal is ORZXYSPOAVJYRU-HOTGVXAUSA-N.
What is the Canonical SMILES of Z-Pro-prolinal?
The Canonical SMILES of Z-Pro-prolinal is C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3).
What is the CAS number of Z-Pro-prolinal?
The CAS number of Z-Pro-prolinal is 88795-32-8.
What is the XLogP3-AA value of Z-Pro-prolinal?
The XLogP3-AA value of Z-Pro-prolinal is 1.7.
How many hydrogen bond acceptors does Z-Pro-prolinal have?
Z-Pro-prolinal has 4 hydrogen bond acceptors.