What is the molecular formula of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The molecular formula is C34H23BO2.
What is the molecular weight of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The molecular weight is 474.4 g/mol.
What is the IUPAC name of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The IUPAC name is (9,10-dinaphthalen-2-ylanthracen-2-yl)boronic acid.
What is the InChI of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The InChI is InChI=1S/C34H23BO2/c36-35(37)28-17-18-31-32(21-28)34(27-16-14-23-8-2-4-10-25(23)20-27)30-12-6-5-11-29(30)33(31)26-15-13-22-7-1-3-9-24(22)19-26/h1-21,36-37H.
What is the InChIKey of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The InChIKey is NVPJWLBDGLWXCH-UHFFFAOYSA-N.
What is the canonical SMILES of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The canonical SMILES is B(C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6)(O)O.
What is the CAS number of 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid?
The CAS number is 867044-28-8.
How many hydrogen bond donor count does 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid have?
It has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 9,10-Bis(2-naphthyl)anthracene-2-ylboronic acid have?
It has 2 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.