What is the molecular formula of 3-Bromo-4-iodoaniline?
The molecular formula of 3-Bromo-4-iodoaniline is C6H5BrIN.
What is the molecular weight of 3-Bromo-4-iodoaniline?
The molecular weight of 3-Bromo-4-iodoaniline is 297.92 g/mol.
What is the IUPAC name of 3-Bromo-4-iodoaniline?
The IUPAC name of 3-Bromo-4-iodoaniline is 3-bromo-4-iodoaniline.
What is the InChI of 3-Bromo-4-iodoaniline?
The InChI of 3-Bromo-4-iodoaniline is InChI=1S/C6H5BrIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2.
What is the InChIKey of 3-Bromo-4-iodoaniline?
The InChIKey of 3-Bromo-4-iodoaniline is HBCBLDVYTZWYLL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-4-iodoaniline?
The canonical SMILES of 3-Bromo-4-iodoaniline is C1=CC(=C(C=C1N)Br)I.
What is the CAS number of 3-Bromo-4-iodoaniline?
The CAS number of 3-Bromo-4-iodoaniline is 860435-38-7.
What is the EC number of 3-Bromo-4-iodoaniline?
The EC number of 3-Bromo-4-iodoaniline is 840-380-2.
Is 3-Bromo-4-iodoaniline a canonicalized compound?
Yes, 3-Bromo-4-iodoaniline is a canonicalized compound.