What is the molecular formula of 7-Octene-1,2-diol?
The molecular formula is C8H16O2.
What is the molecular weight of 7-Octene-1,2-diol?
The molecular weight is 144.21 g/mol.
What is the IUPAC name of 7-Octene-1,2-diol?
The IUPAC name is oct-7-ene-1,2-diol.
What is the InChI of 7-Octene-1,2-diol?
The InChI is InChI=1S/C8H16O2/c1-2-3-4-5-6-8(10)7-9/h2,8-10H,1,3-7H2.
What is the InChIKey of 7-Octene-1,2-diol?
The InChIKey is UXGHWJFURBQKCJ-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Octene-1,2-diol?
The canonical SMILES is C=CCCCCC(CO)O.
What is the CAS number of 7-Octene-1,2-diol?
The CAS number is 85866-02-0.
What is the European Community (EC) Number of 7-Octene-1,2-diol?
The EC Number is 288-704-6.
What is the XLogP3-AA value of 7-Octene-1,2-diol?
The XLogP3-AA value is 1.3.
Is 7-Octene-1,2-diol a canonicalized compound?
Yes, it is a canonicalized compound.
Download
