The molecular formula of the keyword is C12H18NNaO4S.
What is the molecular weight of the keyword?
The molecular weight of the keyword is 295.33 g/mol.
What are the synonyms of the keyword?
The synonyms of the keyword are 82692-93-1, TOOS, 3-(N-Ethyl-3-methylanilino)-2-hydroxypropanesulfonic acid sodium salt, TOOS sodium salt, and Sodium 3-(ethyl(m-tolyl)amino)-2-hydroxypropane-1-sulfonate.
What is the IUPAC name of the keyword?
The IUPAC name of the keyword is sodium;3-(N-ethyl-3-methylanilino)-2-hydroxypropane-1-sulfonate.
What is the InChIkey of the keyword?
The InChIkey of the keyword is IRQRBVOQGUPTLG-UHFFFAOYSA-M.
What is the Canonical SMILES of the keyword?
The Canonical SMILES of the keyword is CCN(CC(CS(=O)(=O)[O-])O)C1=CC=CC(=C1)C.[Na+].
What is the CAS number of the keyword?
The CAS number of the keyword is 82692-93-1.
What is the European Community (EC) number of the keyword?
The European Community (EC) number of the keyword is 617-377-8.
What is the hydrogen bond donor count of the keyword?
The hydrogen bond donor count of the keyword is 1.
What is the hydrogen bond acceptor count of the keyword?
The hydrogen bond acceptor count of the keyword is 5.
※ Please kindly note that our products are for research use only.
Download
![Benzene,1-fluoro-4-[(trans,trans)-4'-pentyl[1,1'-bicyclohexyl]-4-yl]-](https://resource.alfa-chemistry.com/structure/82832-29-9.gif)
