What is the molecular formula of Methyl 5-formyl-2-methoxybenzoate?
The molecular formula of Methyl 5-formyl-2-methoxybenzoate is C10H10O4.
What are the synonyms of Methyl 5-formyl-2-methoxybenzoate?
The synonyms of Methyl 5-formyl-2-methoxybenzoate are METHYL 5-FORMYL-2-METHOXYBENZOATE, 78515-16-9, Methyl5-formyl-2-methoxybenzoate, MFCD10565654, and Benzoic acid, 5-formyl-2-methoxy-, methyl ester.
What is the molecular weight of Methyl 5-formyl-2-methoxybenzoate?
The molecular weight of Methyl 5-formyl-2-methoxybenzoate is 194.18 g/mol.
What is the IUPAC name of Methyl 5-formyl-2-methoxybenzoate?
The IUPAC name of Methyl 5-formyl-2-methoxybenzoate is methyl 5-formyl-2-methoxybenzoate.
What is the InChI of Methyl 5-formyl-2-methoxybenzoate?
The InChI of Methyl 5-formyl-2-methoxybenzoate is InChI=1S/C10H10O4/c1-13-9-4-3-7(6-11)5-8(9)10(12)14-2/h3-6H,1-2H3.
What is the InChIKey of Methyl 5-formyl-2-methoxybenzoate?
The InChIKey of Methyl 5-formyl-2-methoxybenzoate is CNRMXICSYWVJRD-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 5-formyl-2-methoxybenzoate?
The Canonical SMILES of Methyl 5-formyl-2-methoxybenzoate is COC1=C(C=C(C=C1)C=O)C(=O)OC.
What is the CAS number of Methyl 5-formyl-2-methoxybenzoate?
The CAS number of Methyl 5-formyl-2-methoxybenzoate is 78515-16-9.
What is the European Community (EC) number of Methyl 5-formyl-2-methoxybenzoate?
The European Community (EC) number of Methyl 5-formyl-2-methoxybenzoate is 810-013-0.
What is the topological polar surface area of Methyl 5-formyl-2-methoxybenzoate?
The topological polar surface area of Methyl 5-formyl-2-methoxybenzoate is 52.6Ų.
※ Please kindly note that our products are for research use only.