What is the molecular formula of 2-Methyl-1,4-pentadiene?
The molecular formula of 2-Methyl-1,4-pentadiene is C6H10.
What is the molecular weight of 2-Methyl-1,4-pentadiene?
The molecular weight of 2-Methyl-1,4-pentadiene is 82.14 g/mol.
What is the IUPAC name of 2-Methyl-1,4-pentadiene?
The IUPAC name of 2-Methyl-1,4-pentadiene is 2-methylpenta-1,4-diene.
What is the InChI of 2-Methyl-1,4-pentadiene?
The InChI of 2-Methyl-1,4-pentadiene is InChI=1S/C6H10/c1-4-5-6(2)3/h4H,1-2,5H2,3H3.
What is the InChIKey of 2-Methyl-1,4-pentadiene?
The InChIKey of 2-Methyl-1,4-pentadiene is DRWYRROCDFQZQF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-1,4-pentadiene?
The canonical SMILES of 2-Methyl-1,4-pentadiene is CC(=C)CC=C.
What is the CAS number of 2-Methyl-1,4-pentadiene?
The CAS number of 2-Methyl-1,4-pentadiene is 763-30-4.
What is the European Community (EC) number of 2-Methyl-1,4-pentadiene?
The European Community (EC) number of 2-Methyl-1,4-pentadiene is 212-109-2.
What is the UNII of 2-Methyl-1,4-pentadiene?
The UNII of 2-Methyl-1,4-pentadiene is TG8TS4U1ST.