What is the molecular weight of 1,2-Dibromocyclopentene?
The molecular weight of 1,2-Dibromocyclopentene is 225.91 g/mol.
What is the IUPAC name of 1,2-Dibromocyclopentene?
The IUPAC name of 1,2-Dibromocyclopentene is 1,2-dibromocyclopentene.
What is the InChI of 1,2-Dibromocyclopentene?
The InChI of 1,2-Dibromocyclopentene is InChI=1S/C5H6Br2/c6-4-2-1-3-5(4)7/h1-3H2.
What is the InChIKey of 1,2-Dibromocyclopentene?
The InChIKey of 1,2-Dibromocyclopentene is PNWFXPGGROADNS-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Dibromocyclopentene?
The canonical SMILES of 1,2-Dibromocyclopentene is C1CC(=C(C1)Br)Br.
What is the CAS number of 1,2-Dibromocyclopentene?
The CAS number of 1,2-Dibromocyclopentene is 75415-78-0.
What is the XLogP3-AA value of 1,2-Dibromocyclopentene?
The XLogP3-AA value of 1,2-Dibromocyclopentene is 2.6.
How many hydrogen bond donor counts does 1,2-Dibromocyclopentene have?
1,2-Dibromocyclopentene has 0 hydrogen bond donor count.
How many rotatable bond counts does 1,2-Dibromocyclopentene have?
1,2-Dibromocyclopentene has 0 rotatable bond count.