What is the IUPAC name of the compound 4-Pentylphenyl 4-pentylbenzoate?
The IUPAC name of the compound is (4-pentylphenyl) 4-pentylbenzoate.
What is the molecular formula of 4-Pentylphenyl 4-pentylbenzoate?
The molecular formula of 4-Pentylphenyl 4-pentylbenzoate is C23H30O2.
What is the molecular weight of 4-Pentylphenyl 4-pentylbenzoate?
The molecular weight of 4-Pentylphenyl 4-pentylbenzoate is 338.5 g/mol.
What is the InChI of 4-Pentylphenyl 4-pentylbenzoate?
The InChI of 4-Pentylphenyl 4-pentylbenzoate is InChI=1S/C23H30O2/c1-3-5-7-9-19-11-15-21(16-12-19)23(24)25-22-17-13-20(14-18-22)10-8-6-4-2/h11-18H,3-10H2,1-2H3.
What is the InChIKey of 4-Pentylphenyl 4-pentylbenzoate?
The InChIKey of 4-Pentylphenyl 4-pentylbenzoate is VWDNHTVWLXZZEK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Pentylphenyl 4-pentylbenzoate?
The canonical SMILES of 4-Pentylphenyl 4-pentylbenzoate is CCCCCC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)CCCCC.
What is the CAS number of 4-Pentylphenyl 4-pentylbenzoate?
The CAS number of 4-Pentylphenyl 4-pentylbenzoate is 74305-48-9.
What is the European Community (EC) number of 4-Pentylphenyl 4-pentylbenzoate?
The European Community (EC) number of 4-Pentylphenyl 4-pentylbenzoate is 277-812-9.
What is the XLogP3 value of 4-Pentylphenyl 4-pentylbenzoate?
The XLogP3 value of 4-Pentylphenyl 4-pentylbenzoate is 8.4.
How many rotatable bonds are present in 4-Pentylphenyl 4-pentylbenzoate?
There are 11 rotatable bonds present in 4-Pentylphenyl 4-pentylbenzoate.
※ Please kindly note that our products are for research use only.
Download
