What is the molecular formula of 1-Heptyn-3-ol?
The molecular formula of 1-Heptyn-3-ol is C7H12O.
What is the molecular weight of 1-Heptyn-3-ol?
The molecular weight of 1-Heptyn-3-ol is 112.17 g/mol.
What is the IUPAC name of 1-Heptyn-3-ol?
The IUPAC name of 1-Heptyn-3-ol is hept-1-yn-3-ol.
What is the InChI of 1-Heptyn-3-ol?
The InChI of 1-Heptyn-3-ol is InChI=1S/C7H12O/c1-3-5-6-7(8)4-2/h2,7-8H,3,5-6H2,1H3.
What is the InChIKey of 1-Heptyn-3-ol?
The InChIKey of 1-Heptyn-3-ol is SHSFXAVQBIEYMK-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Heptyn-3-ol?
The canonical SMILES of 1-Heptyn-3-ol is CCCCC(C#C)O.
What is the CAS number of 1-Heptyn-3-ol?
The CAS number of 1-Heptyn-3-ol is 7383-19-9.
What is the European Community (EC) number of 1-Heptyn-3-ol?
The European Community (EC) number of 1-Heptyn-3-ol is 616-022-4.
What is the UNII of 1-Heptyn-3-ol?
The UNII of 1-Heptyn-3-ol is 49MA683SO6.
What is the complexity of 1-Heptyn-3-ol?
The complexity of 1-Heptyn-3-ol is 87.8.