What is the molecular formula of 3-Bromo-5-chloropyridine?
The molecular formula of 3-Bromo-5-chloropyridine is C5H3BrClN.
What is the molecular weight of 3-Bromo-5-chloropyridine?
The molecular weight of 3-Bromo-5-chloropyridine is 192.44 g/mol.
When was 3-Bromo-5-chloropyridine created?
3-Bromo-5-chloropyridine was created on March 27, 2005.
When was 3-Bromo-5-chloropyridine last modified?
3-Bromo-5-chloropyridine was last modified on December 2, 2023.
What is the IUPAC name of 3-Bromo-5-chloropyridine?
The IUPAC name of 3-Bromo-5-chloropyridine is 3-bromo-5-chloropyridine.
What is the InChI of 3-Bromo-5-chloropyridine?
The InChI of 3-Bromo-5-chloropyridine is InChI=1S/C5H3BrClN/c6-4-1-5(7)3-8-2-4/h1-3H.
What is the InChIKey of 3-Bromo-5-chloropyridine?
The InChIKey of 3-Bromo-5-chloropyridine is BELDOPUBSLPBCQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chloropyridine?
The canonical SMILES of 3-Bromo-5-chloropyridine is C1=C(C=NC=C1Br)Cl.
What is the CAS number of 3-Bromo-5-chloropyridine?
The CAS number of 3-Bromo-5-chloropyridine is 73583-39-8.
What is the European Community (EC) number of 3-Bromo-5-chloropyridine?
The European Community (EC) number of 3-Bromo-5-chloropyridine is 625-376-9.