What is the molecular formula of 3-Bromophenanthrene?
The molecular formula of 3-Bromophenanthrene is C14H9Br.
What is the molecular weight of 3-Bromophenanthrene?
The molecular weight of 3-Bromophenanthrene is 257.12 g/mol.
What is the IUPAC Name of 3-Bromophenanthrene?
The IUPAC Name of 3-Bromophenanthrene is 3-bromophenanthrene.
What is the InChIKey of 3-Bromophenanthrene?
The InChIKey of 3-Bromophenanthrene is BNGNNFQSUWVWCW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromophenanthrene?
The canonical SMILES of 3-Bromophenanthrene is C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)Br.
What is the CAS number of 3-Bromophenanthrene?
The CAS number of 3-Bromophenanthrene is 715-50-4.
What is the European Community (EC) Number of 3-Bromophenanthrene?
The European Community (EC) Number of 3-Bromophenanthrene is 695-586-3.
What is the DSSTox Substance ID of 3-Bromophenanthrene?
The DSSTox Substance ID of 3-Bromophenanthrene is DTXSID80221716.
What is the Nikkaji Number of 3-Bromophenanthrene?
The Nikkaji Number of 3-Bromophenanthrene is J758.111D.
Is 3-Bromophenanthrene a Canonicalized compound?
Yes, 3-Bromophenanthrene is a canonicalized compound.