What is the molecular formula of 4-Phenylbenzylamine?
The molecular formula of 4-Phenylbenzylamine is C13H13N.
What is the molecular weight of 4-Phenylbenzylamine?
The molecular weight of 4-Phenylbenzylamine is 183.25 g/mol.
What is the IUPAC name of 4-Phenylbenzylamine?
The IUPAC name of 4-Phenylbenzylamine is (4-phenylphenyl)methanamine.
What is the InChI of 4-Phenylbenzylamine?
The InChI of 4-Phenylbenzylamine is InChI=1S/C13H13N/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10,14H2.
What is the InChIKey of 4-Phenylbenzylamine?
The InChIKey of 4-Phenylbenzylamine is RMSPOVPGDBDYKH-UHFFFAOYSA-N.
What is the CAS number of 4-Phenylbenzylamine?
The CAS number of 4-Phenylbenzylamine is 712-76-5.
What is the European Community (EC) number of 4-Phenylbenzylamine?
The European Community (EC) number of 4-Phenylbenzylamine is 628-115-7.
What is the ChEMBL ID of 4-Phenylbenzylamine?
The ChEMBL ID of 4-Phenylbenzylamine is CHEMBL216761.
Is 4-Phenylbenzylamine considered a canonicalized compound?
Yes, 4-Phenylbenzylamine is considered a canonicalized compound.