What is the molecular formula of Acetylalanyltyrosine?
The molecular formula of Acetylalanyltyrosine is C14H18N2O5.
What are the synonyms of Acetylalanyltyrosine?
The synonyms of Acetylalanyltyrosine are Acetyl-ala-tyr, 70529-66-7, CH3CO-Ala-tyr, and acetyl-L-alanyl-L-tyrosine.
What is the molecular weight of Acetylalanyltyrosine?
The molecular weight of Acetylalanyltyrosine is 294.30 g/mol.
When was Acetylalanyltyrosine created?
Acetylalanyltyrosine was created on August 9, 2005.
What is the IUPAC name of Acetylalanyltyrosine?
The IUPAC name of Acetylalanyltyrosine is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
What is the InChI of Acetylalanyltyrosine?
The InChI of Acetylalanyltyrosine is InChI=1S/C14H18N2O5/c1-8(15-9(2)17)13(19)16-12(14(20)21)7-10-3-5-11(18)6-4-10/h3-6,8,12,18H,7H2,1-2H3,(H,15,17)(H,16,19)(H,20,21)/t8-,12-/m0/s1.
What is the InChIKey of Acetylalanyltyrosine?
The InChIKey of Acetylalanyltyrosine is GERBQRKJEQLUQU-UFBFGSQYSA-N.
What is the Canonical SMILES of Acetylalanyltyrosine?
The Canonical SMILES of Acetylalanyltyrosine is CC(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)NC(=O)C.
What is the CAS identifier of Acetylalanyltyrosine?
The CAS identifier of Acetylalanyltyrosine is 70529-66-7.
What is the XLogP3 value of Acetylalanyltyrosine?
The XLogP3 value of Acetylalanyltyrosine is -0.5.