What is the molecular formula of 2,3,5,6-Tetrafluoro-p-xylene?
The molecular formula of 2,3,5,6-Tetrafluoro-p-xylene is C8H6F4.
What is the molecular weight of 2,3,5,6-Tetrafluoro-p-xylene?
The molecular weight of 2,3,5,6-Tetrafluoro-p-xylene is 178.13 g/mol.
What is the IUPAC name of 2,3,5,6-Tetrafluoro-p-xylene?
The IUPAC name of 2,3,5,6-Tetrafluoro-p-xylene is 1,2,4,5-tetrafluoro-3,6-dimethylbenzene.
What is the InChI of 2,3,5,6-Tetrafluoro-p-xylene?
The InChI of 2,3,5,6-Tetrafluoro-p-xylene is InChI=1S/C8H6F4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3.
What is the InChIKey of 2,3,5,6-Tetrafluoro-p-xylene?
The InChIKey of 2,3,5,6-Tetrafluoro-p-xylene is IWKPBYPUIPVYNZ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3,5,6-Tetrafluoro-p-xylene?
The Canonical SMILES of 2,3,5,6-Tetrafluoro-p-xylene is CC1=C(C(=C(C(=C1F)F)C)F)F.
What is the CAS number of 2,3,5,6-Tetrafluoro-p-xylene?
The CAS number of 2,3,5,6-Tetrafluoro-p-xylene is 703-87-7.
What is the EC (European Community) number of 2,3,5,6-Tetrafluoro-p-xylene?
The EC number of 2,3,5,6-Tetrafluoro-p-xylene is 623-020-7.
What is the DSSTox Substance ID of 2,3,5,6-Tetrafluoro-p-xylene?
The DSSTox Substance ID of 2,3,5,6-Tetrafluoro-p-xylene is DTXSID30220572.
Is 2,3,5,6-Tetrafluoro-p-xylene a canonicalized compound?
Yes, 2,3,5,6-Tetrafluoro-p-xylene is a canonicalized compound.