What is the molecular formula of 4-Bromo-3-methylaniline?
The molecular formula of 4-Bromo-3-methylaniline is C7H8BrN.
What is the molecular weight of 4-Bromo-3-methylaniline?
The molecular weight of 4-Bromo-3-methylaniline is 186.05 g/mol.
What is the IUPAC name of 4-Bromo-3-methylaniline?
The IUPAC name of 4-Bromo-3-methylaniline is 4-bromo-3-methylaniline.
What is the InChI of 4-Bromo-3-methylaniline?
The InChI of 4-Bromo-3-methylaniline is InChI=1S/C7H8BrN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3.
What is the InChIKey of 4-Bromo-3-methylaniline?
The InChIKey of 4-Bromo-3-methylaniline is MMEGELSFOYDPQW-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-methylaniline?
The canonical SMILES of 4-Bromo-3-methylaniline is CC1=C(C=CC(=C1)N)Br.
What is the CAS number of 4-Bromo-3-methylaniline?
The CAS number of 4-Bromo-3-methylaniline is 6933-10-4.
What is the EC number of 4-Bromo-3-methylaniline?
The EC number of 4-Bromo-3-methylaniline is 230-056-3.
What is the XLogP3 value of 4-Bromo-3-methylaniline?
The XLogP3 value of 4-Bromo-3-methylaniline is 2.9.
Is 4-Bromo-3-methylaniline a canonicalized compound?
Yes, 4-Bromo-3-methylaniline is a canonicalized compound.