What is the molecular formula of Ethyl 3-bromo-5-nitrobenzoate?
The molecular formula of Ethyl 3-bromo-5-nitrobenzoate is C9H8BrNO4.
What are the synonyms of Ethyl 3-bromo-5-nitrobenzoate?
The synonyms of Ethyl 3-bromo-5-nitrobenzoate are 690260-94-7, MFCD09258760, Benzoic acid, 3-bromo-5-nitro-, ethyl ester, and ETHYL3-BROMO-5-NITROBENZOATE.
What is the molecular weight of Ethyl 3-bromo-5-nitrobenzoate?
The molecular weight of Ethyl 3-bromo-5-nitrobenzoate is 274.07 g/mol.
What is the IUPAC name of Ethyl 3-bromo-5-nitrobenzoate?
The IUPAC name of Ethyl 3-bromo-5-nitrobenzoate is ethyl 3-bromo-5-nitrobenzoate.
What is the InChI of Ethyl 3-bromo-5-nitrobenzoate?
The InChI of Ethyl 3-bromo-5-nitrobenzoate is InChI=1S/C9H8BrNO4/c1-2-15-9(12)6-3-7(10)5-8(4-6)11(13)14/h3-5H,2H2,1H3.
What is the InChIKey of Ethyl 3-bromo-5-nitrobenzoate?
The InChIKey of Ethyl 3-bromo-5-nitrobenzoate is PUBVWGDKFHIPRR-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 3-bromo-5-nitrobenzoate?
The Canonical SMILES of Ethyl 3-bromo-5-nitrobenzoate is CCOC(=O)C1=CC(=CC(=C1)Br)[N+](=O)[O-].
What is the XLogP3 value of Ethyl 3-bromo-5-nitrobenzoate?
The XLogP3 value of Ethyl 3-bromo-5-nitrobenzoate is 3.
How many hydrogen bond donor counts does Ethyl 3-bromo-5-nitrobenzoate have?
Ethyl 3-bromo-5-nitrobenzoate has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Ethyl 3-bromo-5-nitrobenzoate have?
Ethyl 3-bromo-5-nitrobenzoate has 4 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.
Download
