What is the molecular formula of sec-Butyl ether?
The molecular formula of sec-Butyl ether is C8H18O.
What is the molecular weight of sec-Butyl ether?
The molecular weight of sec-Butyl ether is 130.23 g/mol.
What is the IUPAC name of sec-Butyl ether?
The IUPAC name of sec-Butyl ether is 2-butan-2-yloxybutane.
What is the InChI of sec-Butyl ether?
The InChI of sec-Butyl ether is InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3.
What is the InChIKey of sec-Butyl ether?
The InChIKey of sec-Butyl ether is HHBZZTKMMLDNDN-UHFFFAOYSA-N.
What is the canonical SMILES of sec-Butyl ether?
The canonical SMILES of sec-Butyl ether is CCC(C)OC(C)CC.
What is the CAS number of sec-Butyl ether?
The CAS number of sec-Butyl ether is 6863-58-7.
What is the European Community (EC) number of sec-Butyl ether?
The European Community (EC) number of sec-Butyl ether is 229-961-6.
What is the ChEMBL ID of sec-Butyl ether?
The ChEMBL ID of sec-Butyl ether is CHEMBL3184223.
Is sec-Butyl ether a canonicalized compound?
Yes, sec-Butyl ether is a canonicalized compound.