What is the PubChem CID of Diethyl bromomalonate?
The PubChem CID of Diethyl bromomalonate is 69637.
What is the molecular formula of Diethyl bromomalonate?
The molecular formula of Diethyl bromomalonate is C7H11BrO4.
What is the molecular weight of Diethyl bromomalonate?
The molecular weight of Diethyl bromomalonate is 239.06 g/mol.
What is the IUPAC Name of Diethyl bromomalonate?
The IUPAC Name of Diethyl bromomalonate is diethyl 2-bromopropanedioate.
What is the InChI of Diethyl bromomalonate?
The InChI of Diethyl bromomalonate is InChI=1S/C7H11BrO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3.
What is the InChIKey of Diethyl bromomalonate?
The InChIKey of Diethyl bromomalonate is FNJVDWXUKLTFFL-UHFFFAOYSA-N.
What is the canonical SMILES of Diethyl bromomalonate?
The canonical SMILES of Diethyl bromomalonate is CCOC(=O)C(C(=O)OCC)Br.
What is the CAS number of Diethyl bromomalonate?
The CAS number of Diethyl bromomalonate is 685-87-0.
What is the EC Number of Diethyl bromomalonate?
The EC Number of Diethyl bromomalonate is 211-683-1.
What is the XLogP3-AA value of Diethyl bromomalonate?
The XLogP3-AA value of Diethyl bromomalonate is 1.8.