What is the molecular formula of Hexafluoropropene trimer?
The molecular formula of Hexafluoropropene trimer is CF3CF(CF3)CF=C(CF3)CF(CF3)2.
What is the molecular weight of Hexafluoropropene trimer?
The molecular weight of Hexafluoropropene trimer is 450.07 g/mol.
What is the IUPAC name of Hexafluoropropene trimer?
The IUPAC name of Hexafluoropropene trimer is 1,1,2,3,3,3-hexafluoroprop-1-ene.
What is the InChI of Hexafluoropropene trimer?
The InChI of Hexafluoropropene trimer is InChI=1S/3C3F6/c3*4-1(2(5)6)3(7,8)9.
What is the InChIKey of Hexafluoropropene trimer?
The InChIKey of Hexafluoropropene trimer is VJRSWIKVCUMTFK-UHFFFAOYSA-N.
What is the canonical SMILES of Hexafluoropropene trimer?
The canonical SMILES of Hexafluoropropene trimer is C(=C(F)F)(C(F)(F)F)F.C(=C(F)F)(C(F)(F)F)F.C(=C(F)F)(C(F)(F)F)F.
What is the CAS number of Hexafluoropropene trimer?
The CAS number of Hexafluoropropene trimer is 6792-31-0.
What is the European Community (EC) number of Hexafluoropropene trimer?
The European Community (EC) number of Hexafluoropropene trimer is 633-258-3.
How many hydrogen bond donor count does Hexafluoropropene trimer have?
Hexafluoropropene trimer has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does Hexafluoropropene trimer have?
Hexafluoropropene trimer has 18 hydrogen bond acceptor count.