What is the PubChem CID of 2-Bromoresorcinol?
PubChem CID 604810.
What is the molecular formula of 2-Bromoresorcinol?
The molecular formula is C6H5BrO2.
What is the molecular weight of 2-Bromoresorcinol?
The molecular weight is 189.01 g/mol.
What is the IUPAC name of 2-Bromoresorcinol?
The IUPAC name is 2-bromobenzene-1,3-diol.
What is the InChI of 2-Bromoresorcinol?
The InChI is InChI=1S/C6H5BrO2/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H.
What is the InChIKey of 2-Bromoresorcinol?
The InChIKey is UOLPZAPIFFZLMF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromoresorcinol?
The canonical SMILES is C1=CC(=C(C(=C1)O)Br)O.
What is the CAS number of 2-Bromoresorcinol?
The CAS number is 6751-75-3.
What is the European Community (EC) number of 2-Bromoresorcinol?
The EC number is 694-601-0.
Is 2-Bromoresorcinol a canonicalized compound?
Yes, 2-Bromoresorcinol is canonicalized.