What is the molecular formula of 2-Bromo-4-methylphenol?
The molecular formula of 2-Bromo-4-methylphenol is C7H7BrO.
What is the molecular weight of 2-Bromo-4-methylphenol?
The molecular weight of 2-Bromo-4-methylphenol is 187.03 g/mol.
What is the IUPAC name of 2-Bromo-4-methylphenol?
The IUPAC name of 2-Bromo-4-methylphenol is 2-bromo-4-methylphenol.
What is the InChI of 2-Bromo-4-methylphenol?
The InChI of 2-Bromo-4-methylphenol is InChI=1S/C7H7BrO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3.
What is the InChIKey of 2-Bromo-4-methylphenol?
The InChIKey of 2-Bromo-4-methylphenol is MTIDYGLTAOZOGU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-methylphenol?
The canonical SMILES of 2-Bromo-4-methylphenol is CC1=CC(=C(C=C1)O)Br.
What is the CAS number of 2-Bromo-4-methylphenol?
The CAS number of 2-Bromo-4-methylphenol is 6627-55-0.
What is the European Community (EC) Number of 2-Bromo-4-methylphenol?
The European Community (EC) Number of 2-Bromo-4-methylphenol is 229-595-7.
What is the UNII of 2-Bromo-4-methylphenol?
The UNII of 2-Bromo-4-methylphenol is U7N9MXC7HG.
Is 2-Bromo-4-methylphenol a canonicalized compound?
Yes, 2-Bromo-4-methylphenol is a canonicalized compound.