What is the molecular formula of 4-Bromo diphenyl sulfide?
The molecular formula is C12H9BrS.
What is the molecular weight of 4-Bromo diphenyl sulfide?
The molecular weight is 265.17 g/mol.
What is the IUPAC Name of 4-Bromo diphenyl sulfide?
The IUPAC Name is 1-bromo-4-phenylsulfanylbenzene.
What is the InChI of 4-Bromo diphenyl sulfide?
The InChI is InChI=1S/C12H9BrS/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H.
What is the InChIKey of 4-Bromo diphenyl sulfide?
The InChIKey is GLXVKUVWFRUQHW-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromo diphenyl sulfide?
The Canonical SMILES is C1=CC=C(C=C1)SC2=CC=C(C=C2)Br.
What is the CAS number of 4-Bromo diphenyl sulfide?
The CAS number is 65662-88-6.
What is the European Community (EC) number of 4-Bromo diphenyl sulfide?
The European Community (EC) number is 659-370-2.
What is the DSSTox Substance ID of 4-Bromo diphenyl sulfide?
The DSSTox Substance ID is DTXSID70309951.
Is 4-Bromo diphenyl sulfide canonicalized?
Yes, the compound is canonicalized.