What is the molecular formula of Tributylpropynylstannane?
The molecular formula of Tributylpropynylstannane is C15H30Sn.
When was Tributylpropynylstannane created and modified?
Tributylpropynylstannane was created on 2005-07-19 and modified on 2023-12-30.
What is the IUPAC Name of Tributylpropynylstannane as computed by Lexichem TK 2.7.0?
The IUPAC Name of Tributylpropynylstannane is tributyl(prop-1-ynyl)stannane.
What is the InChIKey of Tributylpropynylstannane as computed by InChI 1.0.6?
The InChIKey of Tributylpropynylstannane is KCQJLTOSSVXOCC-UHFFFAOYSA-N.
What is the Canonical SMILES of Tributylpropynylstannane as computed by OEChem 2.3.0?
The Canonical SMILES of Tributylpropynylstannane is CCCC[Sn](CCCC)(CCCC)C#CC.
What is the molecular weight of Tributylpropynylstannane as computed by PubChem 2.2?
The molecular weight of Tributylpropynylstannane is 329.11 g/mol.
What is the CAS number of Tributylpropynylstannane?
The CAS number of Tributylpropynylstannane is 64099-82-7.
How many rotatable bond counts does Tributylpropynylstannane have?
Tributylpropynylstannane has 10 rotatable bond counts.
Is Tributylpropynylstannane a covalently-bonded unit as computed by PubChem?
Yes, Tributylpropynylstannane is a covalently-bonded unit.
How many defined atom stereocenter counts are there in Tributylpropynylstannane?
There are 0 defined atom stereocenter counts in Tributylpropynylstannane.