What is the molecular formula of 4-Chloro-3-nitroaniline?
The molecular formula of 4-Chloro-3-nitroaniline is C6H5ClN2O2.
What is the molecular weight of 4-Chloro-3-nitroaniline?
The molecular weight of 4-Chloro-3-nitroaniline is 172.57 g/mol.
What is the IUPAC name of 4-Chloro-3-nitroaniline?
The IUPAC name of 4-Chloro-3-nitroaniline is 4-chloro-3-nitroaniline.
What is the InChI of 4-Chloro-3-nitroaniline?
The InChI of 4-Chloro-3-nitroaniline is InChI=1S/C6H5ClN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2.
What is the InChIKey of 4-Chloro-3-nitroaniline?
The InChIKey of 4-Chloro-3-nitroaniline is FOHHWGVAOVDVLP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-3-nitroaniline?
The canonical SMILES of 4-Chloro-3-nitroaniline is C1=CC(=C(C=C1N)[N+](=O)[O-])Cl.
What is the CAS number of 4-Chloro-3-nitroaniline?
The CAS number of 4-Chloro-3-nitroaniline is 635-22-3.
What is the Hydrogen Bond Donor Count of 4-Chloro-3-nitroaniline?
The Hydrogen Bond Donor Count of 4-Chloro-3-nitroaniline is 1.
What is the Hydrogen Bond Acceptor Count of 4-Chloro-3-nitroaniline?
The Hydrogen Bond Acceptor Count of 4-Chloro-3-nitroaniline is 3.
What is the Topological Polar Surface Area of 4-Chloro-3-nitroaniline?
The Topological Polar Surface Area of 4-Chloro-3-nitroaniline is 71.8Ų.