What is the molecular formula of 4-acetoxybenzyl alcohol?
The molecular formula of 4-acetoxybenzyl alcohol is C9H10O3.
What is the molecular weight of 4-acetoxybenzyl alcohol?
The molecular weight of 4-acetoxybenzyl alcohol is 166.17 g/mol.
What is the IUPAC name of 4-acetoxybenzyl alcohol?
The IUPAC name of 4-acetoxybenzyl alcohol is [4-(hydroxymethyl)phenyl] acetate.
What is the InChI of 4-acetoxybenzyl alcohol?
The InChI of 4-acetoxybenzyl alcohol is InChI=1S/C9H10O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-5,10H,6H2,1H3.
What is the InChIKey of 4-acetoxybenzyl alcohol?
The InChIKey of 4-acetoxybenzyl alcohol is FKMVNGWJGSSDCF-UHFFFAOYSA-N.
What is the canonical SMILES of 4-acetoxybenzyl alcohol?
The canonical SMILES of 4-acetoxybenzyl alcohol is CC(=O)OC1=CC=C(C=C1)CO.
What is the CAS number of 4-acetoxybenzyl alcohol?
The CAS number of 4-acetoxybenzyl alcohol is 6309-46-2.
What is the European Community (EC) number of 4-acetoxybenzyl alcohol?
The European Community (EC) number of 4-acetoxybenzyl alcohol is 694-374-8.
What is the UNII of 4-acetoxybenzyl alcohol?
The UNII of 4-acetoxybenzyl alcohol is DVR9D9HM52.