What is the molecular formula of 2-Methylpentacosane?
The molecular formula of 2-Methylpentacosane is C26H54.
What are the synonyms for 2-Methylpentacosane?
The synonyms for 2-Methylpentacosane are Cerane, Pentacosane, 2-methyl-, and Iso-hexacosane.
What is the molecular weight of 2-Methylpentacosane?
The molecular weight of 2-Methylpentacosane is 366.7 g/mol.
When was 2-Methylpentacosane created?
2-Methylpentacosane was created on March 27, 2005.
What is the structure of 2-Methylpentacosane?
The structure of 2-Methylpentacosane can be viewed at the provided reference link.
What is the IUPAC name of 2-Methylpentacosane?
The IUPAC name of 2-Methylpentacosane is 2-methylpentacosane.
What is the InChI of 2-Methylpentacosane?
The InChI of 2-Methylpentacosane is InChI=1S/C26H54/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(2)3/h26H,4-25H2,1-3H3.
What is the InChIKey of 2-Methylpentacosane?
The InChIKey of 2-Methylpentacosane is ZRNSSRODJSSVEJ-UHFFFAOYSA-N.
What are the other identifiers for 2-Methylpentacosane?
The other identifiers for 2-Methylpentacosane include CAS number 629-87-8, UNII S0NEC7M413, DSSTox Substance ID DTXSID60335567, Nikkaji Number J95.424A, and Wikidata Q27894183.
What is the XLogP3-AA value of 2-Methylpentacosane?
The XLogP3-AA value of 2-Methylpentacosane is 14.