What is the molecular formula of 1-Ethoxy-2-methylpropane?
The molecular formula is C6H14O.
What are the synonyms for 1-Ethoxy-2-methylpropane?
The synonyms are Ethyl isobutyl ether, Isobutyl ethyl ether, and Ether, ethyl isobutyl.
What is the molecular weight of 1-Ethoxy-2-methylpropane?
The molecular weight is 102.17 g/mol.
When was 1-Ethoxy-2-methylpropane created?
It was created on 2005-03-27.
What is the IUPAC name of 1-Ethoxy-2-methylpropane?
The IUPAC name is 1-ethoxy-2-methylpropane.
What is the InChI of 1-Ethoxy-2-methylpropane?
The InChI is InChI=1S/C6H14O/c1-4-7-5-6(2)3/h6H,4-5H2,1-3H3.
What is the InChIKey of 1-Ethoxy-2-methylpropane?
The InChIKey is RQUBQBFVDOLUKC-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Ethoxy-2-methylpropane?
The Canonical SMILES is CCOCC(C)C.
What is the CAS number of 1-Ethoxy-2-methylpropane?
The CAS number is 627-02-1.
What is the XLogP3-AA value of 1-Ethoxy-2-methylpropane?
The XLogP3-AA value is 1.8.