What is the molecular formula of 4-Methyl-1-pentanol?
The molecular formula of 4-Methyl-1-pentanol is C6H14O.
What is the molecular weight of 4-Methyl-1-pentanol?
The molecular weight of 4-Methyl-1-pentanol is 102.17 g/mol.
What is the IUPAC name of 4-Methyl-1-pentanol?
The IUPAC name of 4-Methyl-1-pentanol is 4-methylpentan-1-ol.
What is the InChI of 4-Methyl-1-pentanol?
The InChI of 4-Methyl-1-pentanol is InChI=1S/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3.
How many hydrogen bond donors are present in 4-Methyl-1-pentanol?
There is 1 hydrogen bond donor in 4-Methyl-1-pentanol.
How many hydrogen bond acceptors are present in 4-Methyl-1-pentanol?
There is 1 hydrogen bond acceptor in 4-Methyl-1-pentanol.
How many rotatable bonds are present in 4-Methyl-1-pentanol?
There are 3 rotatable bonds in 4-Methyl-1-pentanol.
What is the topological polar surface area of 4-Methyl-1-pentanol?
The topological polar surface area of 4-Methyl-1-pentanol is 20.2Ų.
How many heavy atoms are present in 4-Methyl-1-pentanol?
There are 7 heavy atoms in 4-Methyl-1-pentanol.
What is the formal charge of 4-Methyl-1-pentanol?
The formal charge of 4-Methyl-1-pentanol is 0.
Download
