What is the molecular formula of 1,4-Dibromopentane?
The molecular formula of 1,4-Dibromopentane is C5H10Br2.
What is the molecular weight of 1,4-Dibromopentane?
The molecular weight of 1,4-Dibromopentane is 229.94 g/mol.
What is the IUPAC name of 1,4-Dibromopentane?
The IUPAC name of 1,4-Dibromopentane is 1,4-dibromopentane.
What is the InChI of 1,4-Dibromopentane?
The InChI of 1,4-Dibromopentane is InChI=1S/C5H10Br2/c1-5(7)3-2-4-6/h5H,2-4H2,1H3.
What is the InChIKey of 1,4-Dibromopentane?
The InChIKey of 1,4-Dibromopentane is CNBFRBXEGGRSPL-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Dibromopentane?
The canonical SMILES of 1,4-Dibromopentane is CC(CCCBr)Br.
What is the CAS number of 1,4-Dibromopentane?
The CAS number of 1,4-Dibromopentane is 626-87-9.
What is the European Community (EC) number of 1,4-Dibromopentane?
The European Community (EC) number of 1,4-Dibromopentane is 210-967-2.
What is the DSSTox Substance ID of 1,4-Dibromopentane?
The DSSTox Substance ID of 1,4-Dibromopentane is DTXSID40870724.
Is 1,4-Dibromopentane a canonicalized compound?
Yes, 1,4-Dibromopentane is a canonicalized compound.