What is the molecular formula of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The molecular formula of 4-Bromopyridine-2-carboxylic acid ethyl ester is C8H8BrNO2.
What are the synonyms for 4-Bromopyridine-2-carboxylic acid ethyl ester?
The synonyms for 4-Bromopyridine-2-carboxylic acid ethyl ester are Ethyl 4-bromopicolinate, Ethyl 4-bromopyridine-2-carboxylate, and 4-Bromo-pyridine-2-carboxylic acid ethyl ester.
What is the molecular weight of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The molecular weight of 4-Bromopyridine-2-carboxylic acid ethyl ester is 230.06 g/mol.
When was 4-Bromopyridine-2-carboxylic acid ethyl ester created?
4-Bromopyridine-2-carboxylic acid ethyl ester was created on September 1, 2009.
When was 4-Bromopyridine-2-carboxylic acid ethyl ester last modified?
4-Bromopyridine-2-carboxylic acid ethyl ester was last modified on December 2, 2023.
What is the IUPAC name of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The IUPAC name of 4-Bromopyridine-2-carboxylic acid ethyl ester is ethyl 4-bromopyridine-2-carboxylate.
What is the InChI of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The InChI of 4-Bromopyridine-2-carboxylic acid ethyl ester is InChI=1S/C8H8BrNO2/c1-2-12-8(11)7-5-6(9)3-4-10-7/h3-5H,2H2,1H3.
What is the InChIKey of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The InChIKey of 4-Bromopyridine-2-carboxylic acid ethyl ester is ATVHAWNFNGFPEM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The canonical SMILES of 4-Bromopyridine-2-carboxylic acid ethyl ester is CCOC(=O)C1=NC=CC(=C1)Br.
What is the CAS number of 4-Bromopyridine-2-carboxylic acid ethyl ester?
The CAS number of 4-Bromopyridine-2-carboxylic acid ethyl ester is 62150-47-4.
※ Please kindly note that our products are for research use only.