What is the molecular formula of 1,3,5-trimethoxybenzene?
The molecular formula of 1,3,5-trimethoxybenzene is C9H12O3.
What is the molecular weight of 1,3,5-trimethoxybenzene?
The molecular weight of 1,3,5-trimethoxybenzene is 168.19 g/mol.
What is the IUPAC name of 1,3,5-trimethoxybenzene?
The IUPAC name of 1,3,5-trimethoxybenzene is 1,3,5-trimethoxybenzene.
What is the InChI of 1,3,5-trimethoxybenzene?
The InChI of 1,3,5-trimethoxybenzene is InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3.
What is the InChIKey of 1,3,5-trimethoxybenzene?
The InChIKey of 1,3,5-trimethoxybenzene is LKUDPHPHKOZXCD-UHFFFAOYSA-N.
What is the CAS number of 1,3,5-trimethoxybenzene?
The CAS number of 1,3,5-trimethoxybenzene is 621-23-8.
How many hydrogen bond donor counts are there in 1,3,5-trimethoxybenzene?
There are 0 hydrogen bond donor counts in 1,3,5-trimethoxybenzene.
How many hydrogen bond acceptor counts are there in 1,3,5-trimethoxybenzene?
There are 3 hydrogen bond acceptor counts in 1,3,5-trimethoxybenzene.
What is the topological polar surface area of 1,3,5-trimethoxybenzene?
The topological polar surface area of 1,3,5-trimethoxybenzene is 27.7Ų.