What is the molecular formula of 7-Epi Clindamycin 2-Phosphate?
The molecular formula is C18H34ClN2O8PS.
What is the molecular weight of 7-Epi Clindamycin 2-Phosphate?
The molecular weight is 505.0 g/mol.
What is the IUPAC name of 7-Epi Clindamycin 2-Phosphate?
The IUPAC name is [(2R,3R,4S,5R,6R)-6-[(1S,2R)-2-chloro-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate.
What is the InChI of 7-Epi Clindamycin 2-Phosphate?
The InChI is InChI=1S/C18H34ClN2O8PS/c1-5-6-10-7-11(21(3)8-10)17(24)20-12(9(2)19)15-13(22)14(23)16(18(28-15)31-4)29-30(25,26)27/h9-16,18,22-23H,5-8H2,1-4H3,(H,20,24)(H2,25,26,27)/t9-,10-,11+,12-,13-,14+,15-,16-,18-/m1/s1.
What is the InChIKey of 7-Epi Clindamycin 2-Phosphate?
The InChIKey is UFUVLHLTWXBHGZ-AVENPWRCSA-N.
What is the Canonical SMILES of 7-Epi Clindamycin 2-Phosphate?
The Canonical SMILES is CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)OP(=O)(O)O)O)O)C(C)Cl.
What is the CAS number of 7-Epi Clindamycin 2-Phosphate?
The CAS number is 620181-05-7.
What is the UNII of 7-Epi Clindamycin 2-Phosphate?
The UNII is BU9D9Q3TG2.
What is the XLogP3 value of 7-Epi Clindamycin 2-Phosphate?
The XLogP3 value is -1.2.
What is the hydrogen bond acceptor count of 7-Epi Clindamycin 2-Phosphate?
The hydrogen bond acceptor count is 10.
※ Please kindly note that our products are for research use only.